7085-55-4
Chemical Structure
Troxerutin
Synonym(s): Trihydroxyethylrutin
- CAS No.: 7085-55-4
- Formula:C33H42O19
- Molecular Weight:742.68
IUPAC Name: 2-(3,4-bis(2-hydroxyethoxy)phenyl)-5-hydroxy-7-(2-hydroxyethoxy)-3-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((((2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)methyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-one
InChIKey: IYVFNTXFRYQLRP-VVSTWUKXSA-N
SMILES: O=C1C(O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O2)O)O)O)=C(C4=CC=C(OCCO)C(OCCO)=C4)OC5=CC(OCCO)=CC(O)=C15
Biological Activity: Troxerutin, also known as vitamin P4, is a tri-hydroxyethylated derivative of natural bioflavonoid rutins which can inhibit the production of reactive oxygen species (ROS) and depress ER stress-mediated NOD activation.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Troxerutin | 98.0% | Troxerutin, also known as vitamin P4, is a tri-hydroxyethylated derivative of natural bioflavonoid rutins which can inhibit the production of reactive oxygen species (ROS) and depress ER stress-mediated NOD activation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Troxerutin (Standard) | ≥98% | Troxerutin (Standard) is the analytical standard of Troxerutin. This product is intended for research and analytical applications. Troxerutin, also known as vitamin P4, is a tri-hydroxyethylated derivative of natural bioflavonoid rutins which can inhibit the production of reactive oxygen species (ROS) and depress ER stress-mediated NOD activation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||