78524-73-9
Chemical Structure
6"'-Deamino-6"'-hydroxyneomycin B
- CAS No.: 78524-73-9
- Formula:C23H45N5O14
- Molecular Weight:615.63
InChIKey: LJQMKWFPBUGQOO-VCIWKGPPSA-N
SMILES: O[C@H]([C@@H]([C@H](O1)CO)O[C@H]2O[C@H]([C@H]([C@@H]([C@H]2N)O)O)CO)[C@@H]1O[C@H]([C@H]([C@@H](C[C@@H]3N)N)O)[C@@H]3O[C@H]4O[C@@H]([C@H]([C@@H]([C@H]4N)O)O)CN
Biological Activity: 6"'-Deamino-6"'-hydroxyneomycin B is an aminoglycosyl antibiotic that can be produced by Streptomyces fradiae UC 75 and is active against both Gram-positive and Gram-negative bacteria. 6"'-Deamino-6"'-hydroxyneomycin B can be used as an intermediate in the biosynthesis of neomycin[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6"'-Deamino-6"'-hydroxyneomycin B | 6"'-Deamino-6"'-hydroxyneomycin B is an aminoglycosyl antibiotic that can be produced by Streptomyces fradiae UC 75 and is active against both Gram-positive and Gram-negative bacteria. 6"'-Deamino-6"'-hydroxyneomycin B can be used as an intermediate in the biosynthesis of neomycin. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||