81012-89-7
81012-89-7
Chemical Structure
1-Naphthenyl phosphate hydrate sodium
- CAS No.: 81012-89-7
- Formula:C10H10NaO5P
- Molecular Weight:264.15
IUPAC Name: sodium naphthalen-1-yl hydrogen phosphate hydrate
InChIKey: NSWUDGODQXQNON-UHFFFAOYSA-M
SMILES: O=P(O)(OC1=C2C=CC=CC2=CC=C1)O[Na].O
Biological Activity: 1-Naphthenyl phosphate hydrate sodium is commonly used as a flame retardant for various materials such as plastics, textiles, and construction materials. In addition, its potential use as a corrosion inhibitor and as an ingredient in fertilizers and detergents has been investigated. Its hydrated form contains variable amounts of water molecules, which affects its physical properties and applications.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1-Naphthenyl phosphate hydrate sodium | 1-Naphthenyl phosphate hydrate sodium is commonly used as a flame retardant for various materials such as plastics, textiles, and construction materials. In addition, its potential use as a corrosion inhibitor and as an ingredient in fertilizers and detergents has been investigated. Its hydrated form contains variable amounts of water molecules, which affects its physical properties and applications. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
