82671-06-5
Chemical Structure
2,6-Dichloro-5-fluoronicotinic acid
- CAS No.: 82671-06-5
- Formula:C6H2Cl2FNO2
- Molecular Weight:209.99
IUPAC Name: 2,6-dichloro-5-fluoronicotinic acid
InChIKey: LTDGKGCHRNNCAC-UHFFFAOYSA-N
SMILES: O=C(O)C1=C(Cl)N=C(Cl)C(F)=C1
Biological Activity: 2,6-Dichloro-5-fluoropyridine-3-carboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. 2,6-Dichloro-5-fluoropyridine-3-carboxylic acid can be used in the synthesis of TAK-659 (HY-100867)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2,6-Dichloro-5-fluoronicotinic acid | 99.36% | 2,6-Dichloro-5-fluoropyridine-3-carboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. 2,6-Dichloro-5-fluoropyridine-3-carboxylic acid can be used in the synthesis of TAK-659 (HY-100867). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||