86770-71-0
Chemical Structure
Benzyl-PEG4-Azido
- CAS No.: 86770-71-0
- Formula:C15H23N3O4
- Molecular Weight:309.36
IUPAC Name: 13-azido-1-phenyl-2,5,8,11-tetraoxatridecane
InChIKey: TZGOIDVALYTCRF-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCC1=CC=CC=C1
Biological Activity: Benzyl-PEG4-Azido is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Benzyl-PEG4-Azido is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Benzyl-PEG4-Azido | Benzyl-PEG4-Azido is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Benzyl-PEG4-Azido is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||