86770-72-1
Chemical Structure
Benzyl-PEG5-azide
- CAS No.: 86770-72-1
- Formula:C17H27N3O5
- Molecular Weight:353.41
IUPAC Name: 16-azido-1-phenyl-2,5,8,11,14-pentaoxahexadecane
InChIKey: SEXRRFNOZVJOLP-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCC1=CC=CC=C1
Biological Activity: Benzyl-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Benzyl-PEG5-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Benzyl-PEG5-azide | Benzyl-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Benzyl-PEG5-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||