87081-35-4
Chemical Structure
Leptomycin B
Synonym(s): CI 940; LMB
- CAS No.: 87081-35-4
- Formula:C33H48O6
- Molecular Weight:540.73
IUPAC Name: (2E,5S,6R,7S,9R,10E,12E,15R,16Z,18E)-17-ethyl-6-hydroxy-3,5,7,9,11,15-hexamethyl-19-((2S,3S)-3-methyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-8-oxononadeca-2,10,12,16,18-pentaenoic acid
InChIKey: YACHGFWEQXFSBS-XYERBDPFSA-N
SMILES: O=C(O)/C=C(C)/C[C@H](C)[C@@H](O)[C@H](C)C([C@H](C)/C=C(C)/C=C/C[C@@H](C)/C=C(CC)\C=C\[C@H]1[C@@H](C)C=CC(O1)=O)=O
Biological Activity: Leptomycin B (CI 940; LMB) is a potent inhibitor of the nuclear export of proteins. Leptomycin B inactivates CRM1/exportin 1 by covalent modification at a cysteine residue. Leptomycin B is a potent antifungal antibiotic blocking the eukaryotic cell cycle[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Leptomycin B | 99.79% | Leptomycin B (CI 940; LMB) is a potent inhibitor of the nuclear export of proteins. Leptomycin B inactivates CRM1/exportin 1 by covalent modification at a cysteine residue. Leptomycin B is a potent antifungal antibiotic blocking the eukaryotic cell cycle. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Leptomycin B (Standard) | ≥98% | Leptomycin B (Standard) is the analytical standard of Leptomycin B (HY-16909). This product is intended for research and analytical applications. Leptomycin B (CI 940; LMB) is a potent inhibitor of the nuclear export of proteins. Leptomycin B inactivates CRM1/exportin 1 by covalent modification at a cysteine residue. Leptomycin B is a potent antifungal antibiotic blocKing the eukaryotic cell cycle. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||