881025-90-7
Chemical Structure
2-Hydroxy L-tryptophan hydrochloride
- CAS No.: 881025-90-7
- Formula:C11H13ClN2O3
- Molecular Weight:256.69
IUPAC Name: 3-phenylbenzo[b]thiophene
InChIKey: NLKLEPLJCJLJMN-QRPNPIFTSA-N
SMILES: N[C@@H](CC1=C(O)NC2=CC=CC=C12)C(O)=O.Cl
Biological Activity: 2-Hydroxy L-tryptophan hydrochloride is a naturally found amino acid that serves as a precursor to serotonin. 2-Hydroxy L-tryptophan hydrochloride involves enhancing serotonin production within the brain. Serotonin is a neurotransmitter responsible for regulating mood, appetite, and sleep, benefits from the increased levels facilitated by 2-Hydroxy L-tryptophan hydrochloride.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-Hydroxy L-tryptophan hydrochloride | 95.13% | 2-Hydroxy L-tryptophan hydrochloride is a naturally found amino acid that serves as a precursor to serotonin. 2-Hydroxy L-tryptophan hydrochloride involves enhancing serotonin production within the brain. Serotonin is a neurotransmitter responsible for regulating mood, appetite, and sleep, benefits from the increased levels facilitated by 2-Hydroxy L-tryptophan hydrochloride. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||