881914-35-8
Chemical Structure
Azido-FTY720
- CAS No.: 881914-35-8
- Formula:C19H32N4O2
- Molecular Weight:348.48
IUPAC Name: 2-amino-2-(3-azido-4-octylphenethyl)propane-1,3-diol
InChIKey: FLPFGLNTCQQHNS-UHFFFAOYSA-N
SMILES: OCC(CCC1=CC=C(CCCCCCCC)C(N=[N+]=[N-])=C1)(N)CO
Biological Activity: Azido-FTY720 is a photoactivatable analogue of FTY720. Azido-FTY720 is used for identifying binding sites between FTY720 and its receptors[1]. Azido-FTY720 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-FTY720 | Azido-FTY720 is a photoactivatable analogue of FTY720. Azido-FTY720 is used for identifying binding sites between FTY720 and its receptors. Azido-FTY720 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||