88465-81-0
Chemical Structure
Arphamenine B
- CAS No.: 88465-81-0
- Formula:C16H25ClN4O4
- Molecular Weight:372.85
InChIKey: JBDPEPZHJGYZFT-YLAFAASESA-N
SMILES: N=C(N)NCCC[C@H](N)C(C[C@H](C(O)=O)CC1=CC=C(C=C1)O)=O.Cl
Biological Activity: Arphamenine B is a Zn2+-dependent exopeptidase that selectively removes arginine and/or lysine residues from the NH2-terminus of several peptide substrates. Arphamenine B is an inhibitor of aminopeptidase B that can be isolated from bacteria. Arphamenine B enhances the immune response and is used to characterize novel proteases[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arphamenine B | Arphamenine B is a Zn2+-dependent exopeptidase that selectively removes arginine and/or lysine residues from the NH2-terminus of several peptide substrates. Arphamenine B is an inhibitor of aminopeptidase B that can be isolated from bacteria. Arphamenine B enhances the immune response and is used to characterize novel proteases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Foulon T, et al. Aminopeptidase B (EC 3.4.11.6). Int J Biochem Cell Biol. 1999 Jul;31(7):747-50. [Content Brief]
- [2]. Umezawa H, et al. Arphamenines A and B, new inhibitors of aminopeptidase B, produced by bacteria. J Antibiot (Tokyo). 1983 Nov;36(11):1572-5. [Content Brief]
- [3]. Kubo H, et al. Involvement of sperm proteases in the binding of sperm to the vitelline envelope in Xenopus laevis. Zoolog Sci. 2008 Jan;25(1):80-7. [Content Brief]
Keywords