10094-62-9
Chemical Structure
α-D-Glucoheptonic acid sodium
- CAS No.: 10094-62-9
- Formula:C7H17NaO10
- Molecular Weight:284.19
IUPAC Name: sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate dihydrate
InChIKey: JAQDQRUFGHWSGO-FBNUBEQJSA-M
SMILES: O=C(O[Na])[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O.O
Biological Activity: α-D-Glucoheptonic acid sodium is a compound that modulates the immune system, has chelating activity, and can be used in the preparation of cleaning agents.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
α-D-Glucoheptonic acid sodium | 99.43% | α-D-Glucoheptonic acid sodium is a compound that modulates the immune system, has chelating activity, and can be used in the preparation of cleaning agents. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-D-Glucoheptonic acid-d7 sodium | α-D-Glucoheptonic acid-d7 sodium is the deuterium labeled α-D-Glucoheptonic acid sodium (HY-W108801). α-D-Glucoheptonic acid sodium is a compound that modulates the immune system, has chelating activity, and can be used in the preparation of cleaning agents. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||