1643841-88-6
Chemical Structure
APN-Azide
Synonym(s): 3-(4-Azidophenyl)propiolonitrile
- CAS No.: 1643841-88-6
- Formula:C9H4N4
- Molecular Weight:168.15
IUPAC Name: 3-(4-azidophenyl)propiolonitrile
InChIKey: BDLXITYEYYHQNK-UHFFFAOYSA-N
SMILES: N#CC#CC1=CC=C(C=C1)N=[N+]=[N-]
Biological Activity: APN-Azide (3-(4-Azidophenyl)propiolonitrile) is a codon-active compound that can achieve specific labeling of target molecules in biological systems through its unique chemical structure. APN-Azide can be used for bioimaging and the development of molecular probes to study biological processes within cells.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
APN-Azide | 99.1% | APN-Azide (3-(4-Azidophenyl)propiolonitrile) is a codon-active compound that can achieve specific labeling of target molecules in biological systems through its unique chemical structure. APN-Azide can be used for bioimaging and the development of molecular probes to study biological processes within cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||