102036-29-3
Chemical Structure
Protosappanin B
Synonym(s): (-)-Protosappanin B
- CAS No.: 102036-29-3
- Formula:C16H16O6
- Molecular Weight:304.29
IUPAC Name: (S)-7-(hydroxymethyl)-7,8-dihydro-6H-dibenzo[b,d]oxocine-3,7,10,11-tetraol
InChIKey: QRTYTQTVJQUCEP-INIZCTEOSA-N
SMILES: OC1=CC=C2C(OC[C@@](O)(CO)CC3=CC(O)=C(O)C=C23)=C1
Biological Activity: Protosappanin B is a phenolic compound extracted from Caesalpinia sappan. Anti-cancer activity[1]. Protosappanin B induces apoptosis and causes G1 cell cycle arrest in human bladder cancer cells[2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Protosappanin B | 99.65% | Protosappanin B is a phenolic compound extracted from Caesalpinia sappan. Anti-cancer activity. Protosappanin B induces apoptosis and causes G1 cell cycle arrest in human bladder cancer cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Protosappanin B (Standard) | ≥98% | Protosappanin B (Standard) is the analytical standard of Protosappanin B. This product is intended for research and analytical applications. Protosappanin B is a phenolic compound extracted from Caesalpinia sappan. Anti-cancer activity. Protosappanin B induces apoptosis and causes G1 cell cycle arrest in human bladder cancer cells. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Yang X, et al. Antitumor Effects of Purified Protosappanin B Extracted From Lignum Sappan. Integr Cancer Ther. 2016 Mar;15(1):87-95. [Content Brief]
- [2]. Yang X, et al. Protosappanin B promotes apoptosis and causes G1 cell cycle arrest in human bladder cancer cells. Sci Rep. 2019 Jan 31;9(1):1048. [Content Brief]