102814-06-2
Chemical Structure
dUDP disodium
- CAS No.: 102814-06-2
- Formula:C9H12N2Na2O11P2
- Molecular Weight:432.13
IUPAC Name: (2R,3S,4S,5R)-2-(hydroxymethyl)-5-(6-methoxy-9H-purin-9-yl)tetrahydrofuran-3,4-diol
InChIKey: BALXRPMGWFALFO-CDNBRZBRSA-L
SMILES: O=C(C=CN1[C@H]2C[C@H](O)[C@@H](COP(OP(O)(O[Na])=O)(O[Na])=O)O2)NC1=O
Biological Activity: dUDP disodium is a nucleotide that plays a crucial role in the synthesis of DNA. dUDP disodium consists of a uracil base, a ribose, and two phosphate groups. dUDP disodium is also a substrate for the deoxyuridine triphosphate nucleotide hydrolase, which catalyzes the conversion of dUDP to dUMP, which is the precursor for dTTP synthesis. dUDP disodium is involved in various biochemical processes and can be used for various biochemical analyses and applications[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
dUDP disodium | 95.02% | dUDP disodium is a nucleotide that plays a crucial role in the synthesis of DNA. dUDP disodium consists of a uracil base, a ribose, and two phosphate groups. dUDP disodium is also a substrate for the deoxyuridine triphosphate nucleotide hydrolase, which catalyzes the conversion of dUDP to dUMP, which is the precursor for dTTP synthesis. dUDP disodium is involved in various biochemical processes and can be used for various biochemical analyses and applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||