1031-07-8
Chemical Structure
Endosulfan sulfate
- CAS No.: 1031-07-8
- Formula:C9H6Cl6O4S
- Molecular Weight:422.92
IUPAC Name: 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methanobenzo[e][1,3,2]dioxathiepine 3,3-dioxide
InChIKey: AAPVQEMYVNZIOO-UHFFFAOYSA-N
SMILES: ClC12C(Cl)=C(Cl)C(Cl)(C2(Cl)Cl)C3COS(OCC31)(=O)=O
Biological Activity: Endosulfan sulfate is the major metabolite of the insecticide Endosulfan, used for various crops. Endosulfan sulfate is more toxic and persistent than Endosulfan[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Endosulfan sulfate | 99.94% | Endosulfan sulfate is the major metabolite of the insecticide Endosulfan, used for various crops. Endosulfan sulfate is more toxic and persistent than Endosulfan. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Endosulfan sulfate (Standard) | ≥98% | Endosulfan sulfate (Standard) is the analytical standard of Endosulfan sulfate. This product is intended for research and analytical applications. Endosulfan sulfate is the major metabolite of the insecticide Endosulfan, used for various crops. Endosulfan sulfate is more toxic and persistent than Endosulfan. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||