105049-15-8
Chemical Structure
Mytoxin B
- CAS No.: 105049-15-8
- Formula:C29H36O9
- Molecular Weight:528.59
InChIKey: LXIQXFWXXPJPEE-OICCJBEUSA-N
SMILES: CC1=C[C@](O[C@H]2[C@]3(OC3)[C@]4(C)[C@@H](C2)OC(/C=C/CC[C@@]5(C(C)=O)OCC/C([C@H]5O)=C/C(OC6)=O)=O)([H])[C@]46CC1
Biological Activity: Mytoxin B is an ADC cytotoxin. Mytoxin B is a satratoxin-type trichothecene macrolide and is similar to the effect of LY294002 (HY-10108). Mytoxin B induces cell apoptosis via PI3K/Akt pathway[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Mytoxin B | Mytoxin B is an ADC cytotoxin. Mytoxin B is a satratoxin-type trichothecene macrolide and is similar to the effect of LY294002 (HY-10108). Mytoxin B induces cell apoptosis via PI3K/Akt pathway. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||