108890-90-0
Chemical Structure
K-13
- CAS No.: 108890-90-0
- Formula:C29H29N3O8
- Molecular Weight:547.56
IUPAC Name: (5S,8S,11S)-11-acetamido-36-hydroxy-8-(4-hydroxybenzyl)-7,10-dioxo-2-oxa-6,9-diaza-1(1,4),3(1,3)-dibenzenacyclododecaphane-5-carboxylic acid
InChIKey: DMSXHRHXAOCALT-HJOGWXRNSA-N
SMILES: O=C([C@H](CC1=CC=C(OC2=C(O)C=CC(C[C@H](NC3=O)C(O)=O)=C2)C=C1)NC(C)=O)N[C@H]3CC4=CC=C(C=C4)O
Biological Activity: K-13 is a cyclic peptide compound synthesized by a specific organozinc reagent. Its synthesis process involves intermolecular and intramolecular Negishi cross-coupling reactions and is one of the shortest routes reported for the synthesis of such cyclic peptides.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
K-13 | K-13 is a cyclic peptide compound synthesized by a specific organozinc reagent. Its synthesis process involves intermolecular and intramolecular Negishi cross-coupling reactions and is one of the shortest routes reported for the synthesis of such cyclic peptides. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||