1184391-57-8
Chemical Structure
3-AP-Me
- CAS No.: 1184391-57-8
- Formula:C9H13N5S
- Molecular Weight:223.30
IUPAC Name: (E)-2-((3-aminopyridin-2-yl)methylene)-N,N-dimethylhydrazine-1-carbothioamide
InChIKey: DQVSEUUIXQTWRB-WUXMJOGZSA-N
SMILES: NC1=CC=CN=C1/C=N/NC(N(C)C)=S
Biological Activity: 3-AP-Me is a dimethyl derivative of the nucleotide reductase inhibitor 3-AP (SML0568). 3-AP-Me can activate the endoplasmic reticulum (ER) stress pathway by promoting the phosphorylation of eIF2α and increasing the gene expression of transcription factors ATF4 and ATF6, leading to cell apoptosis. Additionally, 3-AP-Me can activate the stress kinases c-Jun N-terminal kinase (JNK) and p38 mitogen-activated protein kinases. 3-AP-Me also leads to the upregulation of the spliced mRNA variant XBP1, can be used in cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-AP-Me | 3-AP-Me is a dimethyl derivative of the nucleotide reductase inhibitor 3-AP (SML0568). 3-AP-Me can activate the endoplasmic reticulum (ER) stress pathway by promoting the phosphorylation of eIF2α and increasing the gene expression of transcription factors ATF4 and ATF6, leading to cell apoptosis. Additionally, 3-AP-Me can activate the stress kinases c-Jun N-terminal kinase (JNK) and p38 mitogen-activated protein kinases. 3-AP-Me also leads to the upregulation of the spliced mRNA variant XBP1, can be used in cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||