120042-14-0
Chemical Structure
L-Azidohomoalanine
- CAS No.: 120042-14-0
- Formula:C4H8N4O2
- Molecular Weight:144.13
IUPAC Name: (S)-2-amino-4-azidobutanoic acid
InChIKey: NNWQLZWAZSJGLY-VKHMYHEASA-N
SMILES: O=C(O)[C@@H](N)CCN=[N+]=[N-]
Biological Activity: L-Azidohomoalanine is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. L-Azidohomoalanine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Azidohomoalanine | L-Azidohomoalanine is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. L-Azidohomoalanine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
