1202063-44-2
1202063-44-2
Chemical Structure
(-)-Aspartic acid-d3
Synonym(s): (R)-Aspartic acid-d3; D-(-)-Aspartic acid-d3
- CAS No.: 1202063-44-2
- Formula:C4H4D3NO4
- Molecular Weight:136.12
IUPAC Name: D-aspartic-2,3,3-d3 acid
InChIKey: CKLJMWTZIZZHCS-MIRRBZTDSA-N
SMILES: OC(C([2H])([C@]([2H])(C(O)=O)N)[2H])=O
Biological Activity: (-)-Aspartic acid-d3 ((R)-Aspartic acid-d3) is the deuterium labeled (-)-Aspartic acid (HY-42068). (-)-Aspartic acid is a pyroptosis inhibitor. (-)-Aspartic acid acts as a neurotransmitter and neuromodulator, participates in hormone synthesis and regulation, and plays a role in nervous system development and endocrine system.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(-)-Aspartic acid-d3 | 99.92% | (-)-Aspartic acid-d3 ((R)-Aspartic acid-d3) is the deuterium labeled (-)-Aspartic acid (HY-42068). (-)-Aspartic acid is a pyroptosis inhibitor. (-)-Aspartic acid acts as a neurotransmitter and neuromodulator, participates in hormone synthesis and regulation, and plays a role in nervous system development and endocrine system. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Aspartic acid (Standard) | 99.78% | (-)-Aspartic acid (Standard) is the analytical standard of (-)-Aspartic acid. This product is intended for research and analytical applications. (-)-Aspartic acid is a pyroptosis inhibitor. (-)-Aspartic acid acts as a neurotransmitter and neuromodulator, participates in hormone synthesis and regulation, and plays a role in nervous system development and endocrine system. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(-)-Aspartic acid | 99.78% | (-)-Aspartic acid is a pyroptosis inhibitor. (-)-Aspartic acid acts as a neurotransmitter and neuromodulator, participates in hormone synthesis and regulation, and plays a role in nervous system development and endocrine system. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
