1204-06-4
Chemical Structure
3-Indoleacrylic acid
- CAS No.: 1204-06-4
- Formula:C11H9NO2
- Molecular Weight:187.20
IUPAC Name: 3-(1H-Indol-3-yl)acrylic acid
InChIKey: PLVPPLCLBIEYEA-AATRIKPKSA-N
SMILES: O=C(/C=C/C1=CNC2=C1C=CC=C2)O
Biological Activity: 3-Indoleacrylic acid is a high-efficient antialgal agent. 3-Indoleacrylic acid increases reactive oxygen species (ROS) production, and inhibits the functions of all the nutrient assimilating genes, down-regulated ribulose-1,5-bisphosphate carboxylase/oxygenase II, and cytochrome f genes in P. donghaiense[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Indoleacrylic acid | 99.78% | 3-Indoleacrylic acid is a high-efficient antialgal agent. 3-Indoleacrylic acid increases reactive oxygen species (ROS) production, and inhibits the functions of all the nutrient assimilating genes, down-regulated ribulose-1,5-bisphosphate carboxylase/oxygenase II, and cytochrome f genes in P. donghaiense. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Indoleacrylic acid-d4 | 99.38% | 3-Indoleacrylic acid-d4 is deuterium labeled 3-Indoleacrylic acid (HY-W015273). 3-Indoleacrylic acid is a high-efficient antialgal agent. 3-Indoleacrylic acid increases reactive oxygen species (ROS) production, and inhibits the functions of all the nutrient assimilating genes, down-regulated ribulose-1,5-bisphosphate carboxylase/oxygenase II, and cytochrome f genes in P. donghaiense. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||