1207294-25-4
Chemical Structure
Tauroursodeoxycholate-d5
Synonym(s): Tauroursodeoxycholic acid-d5; TUDCA-d5; UR 906-d5
- CAS No.: 1207294-25-4
- Formula:C26H40D5NO6S
- Molecular Weight:504.73
IUPAC Name: 2-((R)-4-((3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl-2,2,3,4,4-d5)pentanamido)ethane-1-sulfonic acid
InChIKey: BHTRKEVKTKCXOH-UYRINQEQSA-N
SMILES: C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCC(NCCS(=O)(O)=O)=O)([H])[C@@]3([H])[C@@](CC1)([H])[C@@]4([C@](C([2H])([2H])[C@](C([2H])([2H])C4)([2H])O)([H])C[C@@H]3O)C
Biological Activity: Tauroursodeoxycholate-d5 is the deuterium labeled Tauroursodeoxycholate. Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tauroursodeoxycholate-d5 | Tauroursodeoxycholate-d5 is the deuterium labeled Tauroursodeoxycholate. Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tauroursodeoxycholate (Standard) | ≥98% | Tauroursodeoxycholate (Standard) is the analytical standard of Tauroursodeoxycholate. This product is intended for research and analytical applications. Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tauroursodeoxycholate-d4 | Tauroursodeoxycholate-d4 is deuterium labeled Tauroursodeoxycholate. Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tauroursodeoxycholate-d4-1 | Tauroursodeoxycholate-d4-1 is the deuterium labeled Tauroursodeoxycholate. Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tauroursodeoxycholate | 99.90% | Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an orally active endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
