124904-93-4
Chemical Structure
Ganirelix
- CAS No.: 124904-93-4
- Formula:C80H113ClN18O13
- Molecular Weight:1570.32
SMILES: C([C@@H](NC([C@@H](NC([C@H](NC([C@H](CC1=CC=C(O)C=C1)NC([C@@H](NC([C@H](NC([C@@H](CC2=CC=C(Cl)C=C2)NC([C@@H](CC3=CC4=C(C=C3)C=CC=C4)NC(C)=O)=O)=O)CC=5C=CC=NC5)=O)CO)=O)=O)CCCCN=C(NCC)NCC)=O)CC(C)C)=O)CCCCN=C(NCC)NCC)(=O)N6[C@H](C(N[C@@H](C(N)=O)C)=O)CCC6
Biological Activity: Ganirelix is a competitive and selective gonadotropin releasing hormone (GnRH) antagonist. Ganirelix prevents endogenous GnRH from inducing luteinising hormone (LH) and follicle stimulating hormone relea[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ganirelix | 99.88% | Ganirelix is a competitive and selective gonadotropin releasing hormone (GnRH) antagonist. Ganirelix prevents endogenous GnRH from inducing luteinising hormone (LH) and follicle stimulating hormone relea. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||