128341-11-7
Chemical Structure
Broussoflavonol G
- CAS No.: 128341-11-7
- Formula:C30H34O7
- Molecular Weight:506.59
InChIKey: XYNNBNIJZARIJF-UHFFFAOYSA-N
SMILES: O=C1C(O)=C(C2=C(C/C=C(C)\C)C(C/C=C(C)\C)=C(O)C(O)=C2)OC3=C(C/C=C(C)\C)C(O)=CC(O)=C31
Biological Activity: Broussoflavonol G is an active ingredient of Moraceae plants, which can be isolated from Broussonetia papyrifera. Broussoflavonol G can effectively inhibit Fe2+-induced lipid oxidation in rat brain homogenate and significantly inhibit the proliferation of rat vascular smooth muscle cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Broussoflavonol G | Broussoflavonol G is an active ingredient of Moraceae plants, which can be isolated from Broussonetia papyrifera. Broussoflavonol G can effectively inhibit Fe2+-induced lipid oxidation in rat brain homogenate and significantly inhibit the proliferation of rat vascular smooth muscle cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||