1353012-00-6
Chemical Structure
N3-PEG4-C2-Pfp ester
- CAS No.: 1353012-00-6
- Formula:C17H20F5N3O6
- Molecular Weight:457.35
IUPAC Name: perfluorophenyl 1-azido-3,6,9,12-tetraoxapentadecan-15-oate
InChIKey: QSIFGTAWLLFXPY-UHFFFAOYSA-N
SMILES: O=C(OC1=C(F)C(F)=C(F)C(F)=C1F)CCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: N3-PEG4-C2-Pfp ester is a nonclaevable 4-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG4-C2-Pfp ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG4-C2-Pfp ester | 95.03% | N3-PEG4-C2-Pfp ester is a nonclaevable 4-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG4-C2-Pfp ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
