1354419-08-1
Chemical Structure
5-(3-Azidopropyl)uridine
- CAS No.: 1354419-08-1
- Formula:C12H17N5O6
- Molecular Weight:327.29
IUPAC Name: 5-(3-azidopropyl)-1-((2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione
InChIKey: WXYPHRGYUKZYFQ-UYAYMFIHSA-N
SMILES: OC[C@@H]1[C@H](O)[C@H](O)[C@H](N2C=C(CCCN=[N+]=[N-])C(NC2=O)=O)O1
Biological Activity: 5-(3-Azidopropyl)uridine is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. 5-(3-Azidopropyl)uridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-(3-Azidopropyl)uridine | 5-(3-Azidopropyl)uridine is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis. 5-(3-Azidopropyl)uridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||