137993-41-0
Chemical Structure
Rhodamine 800
- CAS No.: 137993-41-0
- Formula:C26H26ClN3O5
- Molecular Weight:495.95
InChIKey: HACOCUMLBPNDIN-UHFFFAOYSA-M
SMILES: N#CC(C1=CC2=C3N(CCC2)CCCC3=C1[O+]=C45)=C4C=C6CCCN7CCCC5=C76.O=Cl(=O)([O-])=O
Biological Activity: Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodamine 800 | 99.78% | Rhodamine dyes are membrane-permeable cationic fluorescent probes that specifically recognize mitochondrial membrane potentials, thereby attaching to mitochondria and producing bright fluorescence, and at certain concentrations, rhodamine dyes have low toxicity to cells, so they are commonly used to detect mitochondria in animal cells, plant cells, and microorganisms. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords