1416872-50-8
Chemical Structure
Sulfidefluor 7-AM
Synonym(s): SF7-AM
- CAS No.: 1416872-50-8
- Formula:C31H23N7O12
- Molecular Weight:685.55
IUPAC Name: bis(acetoxymethyl) 2,2'-((3',6'-diazido-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-5-carbonyl)azanediyl)diacetate
InChIKey: QIAZHSBWGCYJGQ-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NC1=CC=C2C(OC3=CC(N=[N+]=[N-])=CC=C3C24OC(C5=CC(C(N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)=O)=CC=C54)=O)=C1
Biological Activity: Sulfidefluor 7-AM is a stable hydrogen sulphide (H2S) fluorescent probe[1]. Sulfidefluor 7-AM is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sulfidefluor 7-AM | 95.76% | Sulfidefluor 7-AM is a stable hydrogen sulphide (H2S) fluorescent probe. Sulfidefluor 7-AM is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
