142698-60-0
Chemical Structure
Macrocarpal B
- CAS No.: 142698-60-0
- Formula:C28H40O6
- Molecular Weight:472.61
IUPAC Name: 2,4,6-trihydroxy-5-((S)-1-((1aR,4R,4aR,7S,7aS,7bR)-4-hydroxy-1,1,4,7-tetramethyldecahydro-1H-cyclopropa[e]azulen-7-yl)-3-methylbutyl)isophthalaldehyde
InChIKey: IBLPTYJTKWQCDX-NGLILROZSA-N
SMILES: OC1=C([C@@H](CC(C)C)[C@@]2(C)CC[C@]3([H])[C@]2([H])[C@@]4([H])[C@@](C4(C)C)([H])CC[C@@]3(C)O)C(O)=C(C=O)C(O)=C1C=O
Biological Activity: Macrocarpal B is an antibacterial compounds. Macrocarpal B can be isolated from the branch of Eucalyptus globulus. Macrocarpal B can be used for the research of periodontal disease[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Macrocarpal B | 95.0% | Macrocarpal B is an antibacterial compounds. Macrocarpal B can be isolated from the branch of Eucalyptus globulus. Macrocarpal B can be used for the research of periodontal disease. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||