1428629-71-3
Chemical Structure
Propargyl-PEG3-NHS ester
- CAS No.: 1428629-71-3
- Formula:C14H19NO7
- Molecular Weight:313.30
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 3-(2-(2-(prop-2-yn-1-yloxy)ethoxy)ethoxy)propanoate
InChIKey: YDRPXORAOIYIGV-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCC#C
Biological Activity: Propargyl-PEG3-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG3-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Propargyl-PEG3-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Propargyl-PEG3-NHS ester | 97.0% | Propargyl-PEG3-NHS ester is a PEG/Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs. Propargyl-PEG3-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Propargyl-PEG3-NHS ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||