1447569-78-9
Chemical Structure
Tris(1-chloro-2-propyl) phosphate-d18
Synonym(s): Tris(1-chloropropan-2-yl) phosphate-d18
- CAS No.: 1447569-78-9
- Formula:C9D18Cl3O4P
- Molecular Weight:345.68
IUPAC Name: tris(1-chloropropan-2-yl-1,1,2,3,3,3-d6) phosphate
InChIKey: KVMPUXDNESXNOH-WMQNGQRQSA-N
SMILES: ClC([2H])([2H])C(C([2H])([2H])[2H])([2H])OP(OC(C([2H])([2H])[2H])([2H])C([2H])([2H])Cl)(OC(C([2H])([2H])[2H])([2H])C([2H])([2H])Cl)=O
Biological Activity: Tris(1-chloro-2-propyl) phosphate-d18 (Tris(1-chloropropan-2-yl) phosphate-d18) is a deuterium labeled compound.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tris(1-chloro-2-propyl) phosphate-d18 | 95.0% | Tris(1-chloro-2-propyl) phosphate-d18 (Tris(1-chloropropan-2-yl) phosphate-d18) is a deuterium labeled compound. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tris(1-chloro-2-propyl) phosphate | 98.0% | Tris (1-chloro-2-propyl) phosphate (Tris (1-chloropropan-2-yl) phosphate) is a chlorinated organophosphate flame retardant. Tris (1-chloro-2-propyl) phosphate induces DNA damage, elevates intracellular ROS levels, and triggers oxidative stress. Tris (1-chloro-2-propyl) phosphate disrupts mitochondrial membrane potential, leading to mitochondrial dysfunction. Tris (1-chloro-2-propyl) phosphate can trigger cell Apoptosis. Tris (1-chloro-2-propyl) phosphate reduces the survival rate of umbilical vein endothelial cells at relatively high concentrations. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||