14527-51-6
Chemical Structure
5,10,15,20-Tetrakis(p-tolyl)porphyrin
Synonym(s): 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine
- CAS No.: 14527-51-6
- Formula:C48H38N4
- Molecular Weight:670.84
IUPAC Name: 5,10,15,20-tetra-p-tolylporphyrin
InChIKey: SFQNUQLWBBZIOZ-PJEPRTEXSA-N
SMILES: CC1=CC=C(/C2=C3C=CC(/C(C4=CC=C(C)C=C4)=C(N/5)/C=CC5=C(C6=CC=C(C)C=C6)\C7=N/C(C=C7)=C(C8=CC=C(C)C=C8)\C9=CC=C2N9)=N\3)C=C1
Biological Activity: 5,10,15,20-Tetrakis(p-tolyl)porphyrin (TTP) is an organic compound belonging to the class of porphyrins, a cyclic molecule composed of four pyrrole rings linked together. TTP is a synthetic porphyrin commonly used as a sensitizer for dye-sensitized solar cells and a catalyst for organic reactions. Due to its unique structure, TTP has a series of interesting properties, including at specific wavelengths and its potential as a catalyst for various chemical reactions. In dye-sensitized solar cells, TTPs help convert sunlight into electricity by absorbing photons and transferring electrons to the semiconductor layer of the device. In organic chemistry, TTP is often used as a catalyst for various organic compounds in reactions such as oxidation and reduction. Its ability to selectively bind certain substrates makes it a useful tool for synthesizing complex molecules and studying their properties.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5,10,15,20-Tetrakis(p-tolyl)porphyrin | 97.0% | 5,10,15,20-Tetrakis(p-tolyl)porphyrin (TTP) is an organic compound belonging to the class of porphyrins, a cyclic molecule composed of four pyrrole rings linked together. TTP is a synthetic porphyrin commonly used as a sensitizer for dye-sensitized solar cells and a catalyst for organic reactions. Due to its unique structure, TTP has a series of interesting properties, including at specific wavelengths and its potential as a catalyst for various chemical reactions. In dye-sensitized solar cells, TTPs help convert sunlight into electricity by absorbing photons and transferring electrons to the semiconductor layer of the device. In organic chemistry, TTP is often used as a catalyst for various organic compounds in reactions such as oxidation and reduction. Its ability to selectively bind certain substrates makes it a useful tool for synthesizing complex molecules and studying their properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
