165331-08-8
Chemical Structure
2-Azidoethyl β-D-glucopyranoside
- CAS No.: 165331-08-8
- Formula:C8H15N3O6
- Molecular Weight:249.22
IUPAC Name: (2R,3R,4S,5S,6R)-2-(2-azidoethoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
InChIKey: VGCOVRUENPCVTD-JAJWTYFOSA-N
SMILES: [N-]=[N+]=NCCO[C@@H]1O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO
Biological Activity: 2-Azidoethyl β-D-Glucopyranoside is a biochemical reagent that can be used as a biological material or organic compound for life science related research. 2-Azidoethyl β-D-glucopyranoside is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2-Azidoethyl β-D-glucopyranoside | 2-Azidoethyl β-D-Glucopyranoside is a biochemical reagent that can be used as a biological material or organic compound for life science related research. 2-Azidoethyl β-D-glucopyranoside is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||