17140-71-5
Chemical Structure
Idoxuridine hydrate
Synonym(s): 5-Iodo-2′-deoxyuridine hydrate; 5-IUdR hydrate; IdUrd hydrate
- CAS No.: 17140-71-5
- Formula:C9H13IN2O6
- Molecular Weight:372.11
IUPAC Name: 1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-iodopyrimidine-2,4(1H,3H)-dione hydrate
InChIKey: JWEOOFXTRSOJNN-VWZUFWLJSA-N
SMILES: OC[C@@H]1[C@H](C[C@H](N2C(NC(C(I)=C2)=O)=O)O1)O.O
Biological Activity: Idoxuridine (5-Iodo-2′-deoxyuridine, 5-IUdR, IdUrd) hydrate is an iodinated thymidine analogue that competitively inhibits phosphorylases. Idoxuridine can inhibit viral activity, particularly viral eye infections, including herpes simplex keratitis, by inhibiting DNA polymerase and affecting viral replication. Idoxuridine against feline herpesvirus has the IC50 value of 4.3 μM[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Idoxuridine hydrate | Idoxuridine (5-Iodo-2′-deoxyuridine, 5-IUdR, IdUrd) hydrate is an iodinated thymidine analogue that competitively inhibits phosphorylases. Idoxuridine can inhibit viral activity, particularly viral eye infections, including herpes simplex keratitis, by inhibiting DNA polymerase and affecting viral replication. Idoxuridine against feline herpesvirus has the IC50 value of 4.3 μM. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
