17951-19-8
Chemical Structure
Justicidin B
- CAS No.: 17951-19-8
- Formula:C21H16O6
- Molecular Weight:364.35
IUPAC Name: 9-(benzo[d][1,3]dioxol-5-yl)-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one
InChIKey: RTDRYYULUYRTAN-UHFFFAOYSA-N
SMILES: O=C1OCC2=CC3=CC(OC)=C(OC)C=C3C(C4=CC=C(OCO5)C5=C4)=C12
Biological Activity: Justicidin B is a potent anticancer lignan and proapoptotic agent. Justicidin B is also a bone resorption inhibitor, and has strong antiviral, fungicidal, antiprotozoal effects. Justicidin B significantly inhibits platelet aggregation[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Justicidin B | 99.75% | Justicidin B is a potent anticancer lignan and proapoptotic agent. Justicidin B is also a bone resorption inhibitor, and has strong antiviral, fungicidal, antiprotozoal effects. Justicidin B significantly inhibits platelet aggregation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Jürg Gertsch, et al. Antifungal, antiprotozoal, cytotoxic and piscicidal properties of Justicidin B and a new arylnaphthalide lignan from Phyllanthus piscatorum. Planta Med. 2003 May;69(5):420-4. [Content Brief]
- [2]. G Momekov, et al. Effect of justicidin B - a potent cytotoxic and pro-apoptotic arylnaphtalene lignan on human breast cancer-derived cell lines. Neoplasma. 2011;58(4):320-5. [Content Brief]
- [3]. Iliana Ionkova, et al. Linum narbonense: A new valuable tool for biotechnological production of a potent anticancer lignan Justicidine B. Pharmacogn Mag. 2013 Jan;9(33):39-44. [Content Brief]
Keywords