1838643-41-6
Chemical Structure
Cy3 maleimide chloride
- CAS No.: 1838643-41-6
- Formula:C36H43ClN4O3
- Molecular Weight:615.20
InChIKey: WONAOVDQEMKIMH-UHFFFAOYSA-N
SMILES: O=C1C=CC(N1CCNC(CCCCCN2C3=C(C(C)(C)/C2=C\C=C\C4=[N+](C)C5=C(C4(C)C)C=CC=C5)C=CC=C3)=O)=O.[Cl-]
Biological Activity: Cy3 maleimide chloride is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) containing maleimide functional groups. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The alkyne functional group of Cy3 maleimide chloride can undergo a "thiol-acrylamide" reaction with molecules containing sulfur-oxygen functional groups to form covalent bonds. Cy3 maleimide chloride can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cy3 maleimide chloride | 99.25% | Cy3 maleimide chloride is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) containing maleimide functional groups. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The alkyne functional group of Cy3 maleimide chloride can undergo a "thiol-acrylamide" reaction with molecules containing sulfur-oxygen functional groups to form covalent bonds. Cy3 maleimide chloride can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
