184877-65-4
Chemical Structure
Madindoline B
- CAS No.: 184877-65-4
- Formula:C22H27NO4
- Molecular Weight:369.45
InChIKey: XPVQXXLKOCZMGG-FDFHNCONSA-N
SMILES: O[C@@](C1=CC=CC=C12)(CCO3)[C@@]3([H])N2C[C@@]4(C(C(CCCC)=C(C4=O)C)=O)C
Biological Activity: Madindoline B is an IL-6 inhibitor. Madindoline B inhibits IL-6-dependent MH-60 cells and has no inhibitory effect on IL-6-independent MH-60 cells. In the presence of 0.1 U/mL IL-6, it inhibits IL-6-dependent MH-60 cells with an IC50 of 30 μM. Madindoline B has no antimicrobial effect[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Madindoline B | Madindoline B is an IL-6 inhibitor. Madindoline B inhibits IL-6-dependent MH-60 cells and has no inhibitory effect on IL-6-independent MH-60 cells. In the presence of 0.1 U/mL IL-6, it inhibits IL-6-dependent MH-60 cells with an IC50 of 30 μM. Madindoline B has no antimicrobial effect. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords