1859-87-6
Chemical Structure
Echinulin
Synonym(s): Echinuline
- CAS No.: 1859-87-6
- Formula:C29H39N3O2
- Molecular Weight:461.64
IUPAC Name: (3S,6S)-3-((5,7-bis(3-methylbut-2-en-1-yl)-2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl)methyl)-6-methylpiperazine-2,5-dione
InChIKey: DIKMWTRJIZQJMY-CYFREDJKSA-N
SMILES: C/C(C)=C\CC1=C2C(C(C[C@H]3C(N[C@H](C(N3)=O)C)=O)=C(C(C)(C)C=C)N2)=CC(C/C=C(C)\C)=C1
Biological Activity: Echinulin (Echinuline) is a cyclic dipeptide carrying a triprenylated indole moiety. Echinulin contributes to the activation of T cell subsets, which leads to NF-κB activation.Echinulin exerts its immune roles by the NF-κB pathway.Echinulin has the potential to serve as a immunotherapeutic agent[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Echinulin | 98.63% | Echinulin (Echinuline) is a cyclic dipeptide carrying a triprenylated indole moiety. Echinulin contributes to the activation of T cell subsets, which leads to NF-κB activation.Echinulin exerts its immune roles by the NF-κB pathway.Echinulin has the potential to serve as a immunotherapeutic agent. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||