1922891-74-4
Chemical Structure
N3-D-Dab(Boc)-OH
- CAS No.: 1922891-74-4
- Formula:C9H16N4O4
- Molecular Weight:244.25
IUPAC Name: (R)-2-azido-4-((tert-butoxycarbonyl)amino)butanoic acid
InChIKey: JLMWKZYQNHSSAD-ZCFIWIBFSA-N
SMILES: CC(C)(C)OC(NCC[C@H](C(O)=O)N=[N+]=[N-])=O
Biological Activity: N3-D-Dab(Boc)-OH is a click chemistry reagent containing an Azide[1]. N3-D-Dab(Boc)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-D-Dab(Boc)-OH | N3-D-Dab(Boc)-OH is a click chemistry reagent containing an Azide. N3-D-Dab(Boc)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
