1994300-35-4
Chemical Structure
N3-D-Lys(Fmoc)-OH
- CAS No.: 1994300-35-4
- Formula:C21H22N4O4
- Molecular Weight:394.42
IUPAC Name: (R)-6-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-azidohexanoic acid
InChIKey: QETYFSMTHHMLJP-LJQANCHMSA-N
SMILES: [N-]=[N+]=N[C@@H](C(O)=O)CCCCNC(OCC1C2=CC=CC=C2C3=CC=CC=C31)=O
Biological Activity: N3-D-Lys(Fmoc)-OH is a click chemistry reagent containing an azide group. Click chemistry is a powerful chemical reaction with excellent bioorthogonality features: biocompatible, rapid and highly specific in biological environments[1]. N3-D-Lys(Fmoc)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-D-Lys(Fmoc)-OH | N3-D-Lys(Fmoc)-OH is a click chemistry reagent containing an azide group. Click chemistry is a powerful chemical reaction with excellent bioorthogonality features: biocompatible, rapid and highly specific in biological environments. N3-D-Lys(Fmoc)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||