203002-58-8
Chemical Structure
NIP 142
- CAS No.: 203002-58-8
- Formula:C23H27N3O6
- Molecular Weight:441.48
InChIKey: HWADWMAQVCHLHJ-FCHUYYIVSA-N
SMILES: COC(C=C1)=CC=C1CC(NC2=C([N+]([O-])=O)C=C(OC(C)([C@@H]3O)C)C([C@@H]3NC4CC4)=C2)=O
Biological Activity: NIP-142 is a benzopyran derivative with multiple ion channel-blocking effects. NIP-142 selectively blocks the potassium ion channels enriched in atrial muscle, prolonging the effective refractory period (ERP) and action potential duration (APD) of the atrium, while having minimal effect on ventricular repolarization. NIP-142 also inhibits L-type/T-type calcium channels and sodium channels, further contributing to its anti-arrhythmic effect. NIP-142 shows significant efficacy in various atrial fibrillation models. NIP-142 can be used for research on arrhythmias[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NIP 142 | NIP-142 is a benzopyran derivative with multiple ion channel-blocking effects. NIP-142 selectively blocks the potassium ion channels enriched in atrial muscle, prolonging the effective refractory period (ERP) and action potential duration (APD) of the atrium, while having minimal effect on ventricular repolarization. NIP-142 also inhibits L-type/T-type calcium channels and sodium channels, further contributing to its anti-arrhythmic effect. NIP-142 shows significant efficacy in various atrial fibrillation models. NIP-142 can be used for research on arrhythmias. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||