2083-68-3
Chemical Structure
Trimethyloctylammonium bromide
Synonym(s): Trimethyl-n-octylammonium bromide
- CAS No.: 2083-68-3
- Formula:C11H26BrN
- Molecular Weight:252.23
IUPAC Name: N,N,N-trimethyloctan-1-aminium bromide
InChIKey: XCOHAFVJQZPUKF-UHFFFAOYSA-M
SMILES: CCCCCCCC[N+](C)(C)C.[Br-]
Biological Activity: Trimethyloctylammonium bromide (TOAB) is used as a surfactant and phase transfer catalyst in various chemical reactions. TOAB can be used in the synthesis of nanomaterials due to its ability to selectively transfer ions across interfaces and as a surfactant in the production of emulsions and foams. It is valued for its amphiphilic properties, which allow it to interact with water and oils, stabilizing and dispersing mixtures.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trimethyloctylammonium bromide | 99.63% | Trimethyloctylammonium bromide (TOAB) is used as a surfactant and phase transfer catalyst in various chemical reactions. TOAB can be used in the synthesis of nanomaterials due to its ability to selectively transfer ions across interfaces and as a surfactant in the production of emulsions and foams. It is valued for its amphiphilic properties, which allow it to interact with water and oils, stabilizing and dispersing mixtures. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||