2093120-32-0
Chemical Structure
PA Janelia Fluor® 646, SE
Synonym(s): PA-JF646-NHS
- CAS No.: 2093120-32-0
- Formula:C34H31N5O5Si
- Molecular Weight:617.73
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 3,7-di(azetidin-1-yl)-2'-diazo-5,5-dimethyl-3'-oxo-2',3'-dihydro-5H-spiro[dibenzo[b,e]siline-10,1'-indene]-6'-carboxylate
InChIKey: XVIATAHKOZWKHH-UHFFFAOYSA-N
SMILES: O=C(C1=CC(C2(C3=CC=C(N4CCC4)C=C3[Si](C)(C)C5=C2C=CC(N6CCC6)=C5)C7=[N+]=[N-])=C(C=C1)C7=O)ON8C(CCC8=O)=O
Biological Activity: PA Janelia Fluor? 646, SE (PA-JF646-NHS) is a photo-activatable fluorescent dye. PA Janelia Fluor? 646, SE is a far-red light-excited, 405nm-activated NHS ester-based dye (λEx/Em = 650/664 nm). Janelia Fluor? fluorescent dyes can be chemically conjugated to the specific HaloTag substrate (a chloroalkane ligand) to form a fluorescent ligand, rather than binding directly to the HaloTag protein itself. PA Janelia Fluor? 646, SE can achieve extremely low background and single-molecule-level ultra-high-resolution imaging through photo-controlled switching, making it a powerful tool for live cell super-resolution microscopy technology(Ex/Em = 646/664 nm).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PA Janelia Fluor® 646, SE | 99.0% | PA Janelia Fluor? 646, SE (PA-JF646-NHS) is a photo-activatable fluorescent dye. PA Janelia Fluor? 646, SE is a far-red light-excited, 405nm-activated NHS ester-based dye (λEx/Em = 650/664 nm). Janelia Fluor? fluorescent dyes can be chemically conjugated to the specific HaloTag substrate (a chloroalkane ligand) to form a fluorescent ligand, rather than binding directly to the HaloTag protein itself. PA Janelia Fluor? 646, SE can achieve extremely low background and single-molecule-level ultra-high-resolution imaging through photo-controlled switching, making it a powerful tool for live cell super-resolution microscopy technology(Ex/Em = 646/664 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
