2095244-07-6
Chemical Structure
Siegeside B
- CAS No.: 2095244-07-6
- Formula:C26H44O8
- Molecular Weight:484.62
InChIKey: QWWPCQGHWWNGET-GRNJIJAUSA-N
SMILES: C[C@]12[C@@]3([H])C(CC[C@]1([H])C(C)([C@@H](CC2)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)C)=C[C@](C)(CC3)[C@H](O)CO
Biological Activity: Siegeside B is a diterpenoid glycoside found in the dried aerial parts of Siegesbeckia pubescens. Siegeside B inhibits epidermal growth factor-induced migration and invasion of breast cancer cells. Siegeside B can be used for the research of breast cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Siegeside B | Siegeside B is a diterpenoid glycoside found in the dried aerial parts of Siegesbeckia pubescens. Siegeside B inhibits epidermal growth factor-induced migration and invasion of breast cancer cells. Siegeside B can be used for the research of breast cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||