2098497-01-7
Chemical Structure
6-Azido-D-lysine hydrochloride
- CAS No.: 2098497-01-7
- Formula:C6H13ClN4O2
- Molecular Weight:208.65
IUPAC Name: (S)-4-(tert-butyl)-2-(2-((R)-4-(tert-butyl)-4,5-dihydrooxazol-2-yl)-1,3-diphenylpropan-2-yl)-4,5-dihydrooxazole
InChIKey: RCEAACZNVVRXSJ-NUBCRITNSA-N
SMILES: OC([C@H](N)CCCCN=[N+]=[N-])=O.Cl
Biological Activity: 6-Azido-D-lysine hydrochloride is a click chemistry reagent containing an azide[1]. 6-Azido-D-lysine hydrochloride is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6-Azido-D-lysine hydrochloride | ≥98.0% | 6-Azido-D-lysine hydrochloride is a click chemistry reagent containing an azide. 6-Azido-D-lysine hydrochloride is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
