2102057-88-3
Chemical Structure
NH2-C4-NH-Boc-d8
- CAS No.: 2102057-88-3
- Formula:C9H12D8N2O2
- Molecular Weight:196.32
InChIKey: ZFQWJXFJJZUVPI-DUSUNJSHSA-N
SMILES: [2H]C([2H])(N)C([2H])([2H])C([2H])([2H])C([2H])(NC(OC(C)(C)C)=O)[2H]
Biological Activity: NH2-C4-NH-Boc-d8 is the deuterium labeled NH2-C4-NH-Boc (HY-40178). NH2-C4-NH-Boc (compound 15) is a PROTAC linker, which refers to the Alkyl/ether composition. NH2-C4-NH-Boc can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NH2-C4-NH-Boc-d8 | NH2-C4-NH-Boc-d8 is the deuterium labeled NH2-C4-NH-Boc (HY-40178). NH2-C4-NH-Boc (compound 15) is a PROTAC linker, which refers to the Alkyl/ether composition. NH2-C4-NH-Boc can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
NH2-C4-NH-Boc | 99.97% | NH2-C4-NH-Boc (compound 15) is a PROTAC linker, which refers to the Alkyl/ether composition. NH2-C4-NH-Boc can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
