2182601-72-3
Chemical Structure
Cy5 DBCO chloride
- CAS No.: 2182601-72-3
- Formula:C50H53ClN4O2
- Molecular Weight:777.43
IUPAC Name: 3-octadecyl-2-((1E,3E)-3-(3-octadecylbenzo[d]thiazol-2(3H)-ylidene)prop-1-en-1-yl)benzo[d]thiazol-3-ium perchlorate
InChIKey: HWIXBRHDYGXXEQ-UHFFFAOYSA-N
SMILES: CC1(C)C(/C=C/C=C/C=C2N(CCCCCC(NCCC(N3C4=CC=CC=C4C#CC5=CC=CC=C5C3)=O)=O)C6=C(C=CC=C6)C/2(C)C)=[N+](C)C7=C1C=CC=C7.[Cl-]
Biological Activity: Cy5 DBCO chloride is an azide reaction probe and the addition of DBCO molecules allows the imaging of azide-labelled biomolecules by a copper-free "Click Chemistry" reaction[1]. Cy5 DBCO (chloride) is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cy5 DBCO chloride | Cy5 DBCO chloride is an azide reaction probe and the addition of DBCO molecules allows the imaging of azide-labelled biomolecules by a copper-free "Click Chemistry" reaction. Cy5 DBCO (chloride) is a click chemistry reagent, it contains a DBCO group that can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||