2213408-17-2
Chemical Structure
HYNIC-PSMA
- CAS No.: 2213408-17-2
- Formula:C24H37N7O9
- Molecular Weight:567.59
InChIKey: FZSZRXIUKIJFEN-IRXDYDNUSA-N
SMILES: O=C([C@H](CCC(O)=O)NC(N[C@@H](CCCCNC(CCCCCNC(C1=CN=C(C=C1)NN)=O)=O)C(O)=O)=O)O
Biological Activity: HYNIC-PSMA is a ligand for molecular imaging of tumors. Hynic-psma consists of two components: HYNIC (6-hydrazinonicotinamide) and PSMA (Prostate-Specific Membrane Antigen). HYNIC is a compound used to attach radioactive isotopes to targeted molecules, such as 188Re-HYNIC-PSMA. PSMA is a membrane antigen that is specifically expressed on the surface of prostate cancer cells. HYNIC-PSMA can be used in prostate cancer research[1]. HYNIC-PSMA can be used for the synthesis/research of Radionuclide-Drug Conjugates (RDCs).
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
HYNIC-PSMA | 98.67% | HYNIC-PSMA is a ligand for molecular imaging of tumors. Hynic-psma consists of two components: HYNIC (6-hydrazinonicotinamide) and PSMA (Prostate-Specific Membrane Antigen). HYNIC is a compound used to attach radioactive isotopes to targeted molecules, such as 188Re-HYNIC-PSMA. PSMA is a membrane antigen that is specifically expressed on the surface of prostate cancer cells. HYNIC-PSMA can be used in prostate cancer research. HYNIC-PSMA can be used for the synthesis/research of Radionuclide-Drug Conjugates (RDCs). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||