2228039-87-8
Chemical Structure
Otviciclib
- CAS No.: 2228039-87-8
- Formula:C26H30Cl2N8O4S
- Molecular Weight:621.54
SMILES: O=C1N=C(CC2=CC=C(NC(CN(CC)CC)=O)C=C2)NC3=C1C(N(C)C)=NN3C4=C(C=C(S(=O)(N)=O)C=C4Cl)Cl
Biological Activity: Otviciclib (Compound 86) is a CDK inhibitor. Otviciclib has potent anti-proliferative activity against solid tumor cells (such as HCT116, NCIH82 and DU145 cells) with no significant toxicity to normal cells, and effectively induces the G2/M phase cells arrest and apoptosis. Otviciclib has a broad-spectrum anticancer activity, such as colon, pancreatic and lung cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Otviciclib | Otviciclib (Compound 86) is a CDK inhibitor. Otviciclib has potent anti-proliferative activity against solid tumor cells (such as HCT116, NCIH82 and DU145 cells) with no significant toxicity to normal cells, and effectively induces the G2/M phase cells arrest and apoptosis. Otviciclib has a broad-spectrum anticancer activity, such as colon, pancreatic and lung cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||