2230788-62-0
Chemical Structure
CPhos Pd G2
- CAS. Nr.: 2230788-62-0
- Formula:C40H51ClN3PPd
- Molecular Weight:746.70
InChIKey: UVCXUQFGSLERHU-UHFFFAOYSA-M
SMILES: [Cl-][Pd+2]1([P](C2CCCCC2)(C3CCCCC3)C4=CC=CC=C4C5=C(N(C)C)C=CC=C5N(C)C)[C-]6=C(C7=C([NH2]1)C=CC=C7)C=CC=C6
Biological Activity: CPhos Pd G2 is a highly efficient palladium catalyst with excellent cross-coupling reaction activity. CPhos Pd G2 is widely used in compound synthesis and material science, especially for the construction of complex organic molecules and the synthesis of bioactive compounds. CPhos Pd G2 is also favored for improving reaction selectivity and reducing the formation of by-products.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CPhos Pd G2 | CPhos Pd G2 is a highly efficient palladium catalyst with excellent cross-coupling reaction activity. CPhos Pd G2 is widely used in compound synthesis and material science, especially for the construction of complex organic molecules and the synthesis of bioactive compounds. CPhos Pd G2 is also favored for improving reaction selectivity and reducing the formation of by-products. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||